![6-[2-phenylethyl(propyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol;hydrochloride (CAS: 71787-90-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0757152.png "6-[2-phenylethyl(propyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol;hydrochloride chemical structure")
6-[2-phenylethyl(propyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol;hydrochloride
Catalog No: FT-0757152
CAS No: 71787-90-1
- Chemical Name: 6-[2-phenylethyl(propyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol;hydrochloride
- Molecular Formula: C21H28ClNO
- Molecular Weight: 345.9
- InChI Key: XWLCIDLCEZAOEY-UHFFFAOYSA-N
- InChI: InChI=1S/C21H27NO.ClH/c1-2-14-22(15-13-17-7-4-3-5-8-17)19-11-12-20-18(16-19)9-6-10-21(20)23;/h3-10,19,23H,2,11-16H2,1H3;1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 468ºC at 760 mmHg |
|---|---|
| CAS: | 71787-90-1 |
| MF: | C21H28ClNO |
| Density: | N/A |
| Melting_Point: | N/A |
| Product_Name: | 6-[2-phenylethyl(propyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol,hydrochloride |
| Flash_Point: | 228.6ºC |
| FW: | 345.90600 |
| MF: | C21H28ClNO |
|---|---|
| LogP: | 5.00620 |
| Exact_Mass: | 345.18600 |
| Bolling_Point: | 468ºC at 760 mmHg |
| Flash_Point: | 228.6ºC |
| FW: | 345.90600 |
| PSA: | 23.47000 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
